|
|
| | Methyltetrahydrophthalic anhydride Basic information |
| Product Name: | Methyltetrahydrophthalic anhydride | | Synonyms: | 1,3-Isobenzofurandione, 3a,4,7,7a-tetrahydromethyl-;3a,4,7,7a-tetrahydromethyl-3-isobenzofurandione;3-Isobenzofurandione,3a,4,7,7a-tetrahydromethyl-1;AC 220;AC 220J;METHYL-1,2,3,6-TETRAHYDROPHTHALIC ANHYDRIDE;MTHPA-EG;TIMTEC-BB SBB008353 | | CAS: | 26590-20-5 | | MF: | C9H10O3 | | MW: | 166.17 | | EINECS: | 247-830-1 | | Product Categories: | Resin;Diels-Alder Adducts;REALET | | Mol File: | 26590-20-5.mol |  |
| | Methyltetrahydrophthalic anhydride Chemical Properties |
| Melting point | 63-64 °C | | Boiling point | 254.38°C (rough estimate) | | density | 1.1708 (rough estimate) | | refractive index | 1.5500 (estimate) | | storage temp. | -20°C Freezer | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | White | | InChI | InChI=1S/C9H10O3/c1-9-5-3-2-4-6(9)7(10)12-8(9)11/h3,5-6H,2,4H2,1H3 | | InChIKey | CSHJJWDAZSZQBT-UHFFFAOYSA-N | | SMILES | C1(OC(=O)C2CCC=CC12C)=O | | CAS DataBase Reference | 26590-20-5(CAS DataBase Reference) | | NIST Chemistry Reference | Methyltetrahydrophthalic anhydride(26590-20-5) | | EPA Substance Registry System | 1,3-Isobenzofurandione, 3a,4,7,7a-tetrahydromethyl- (26590-20-5) |
| | Methyltetrahydrophthalic anhydride Usage And Synthesis |
| Chemical Properties | light yellow liquid,colorless liquid | | Uses | AC 220 is a uniquely potent and selective inhibitor of FLT3 for the treatment of acute myeloid leukemia (AML). | | Definition | ChEBI: A cyclic dicarboxylic anhydride that is the cyclic anhydride of methyltetrahydrophthalic acid. |
| | Methyltetrahydrophthalic anhydride Preparation Products And Raw materials |
|