- hexyl D-glucoside
-
- $0.00 / 1KG
-
2025-02-12
- CAS:54549-24-5
- Min. Order: 1KG
- Purity: 98%min
- Supply Ability: 30tons/month
|
| | hexyl D-glucoside Basic information |
| Product Name: | hexyl D-glucoside | | Synonyms: | hexyl D-glucoside;Hexyl-D-glucosid;D-Glucopyranoside, hexyl;C6 Alkyl glucoside;APG06，C6 Alkyl glucoside | | CAS: | 54549-24-5 | | MF: | C12H24O6 | | MW: | 264.32 | | EINECS: | 259-217-6 | | Product Categories: | | | Mol File: | 54549-24-5.mol |  |
| | hexyl D-glucoside Chemical Properties |
| Boiling point | 432.3±45.0 °C(Predicted) | | density | 1.23±0.1 g/cm3(Predicted) | | vapor pressure | 0.001Pa at 20℃ | | pka | 12.96±0.70(Predicted) | | Water Solubility | 750g/L at 20℃ | | InChI | InChI=1S/C12H24O6/c1-2-3-4-5-6-17-12-11(16)10(15)9(14)8(7-13)18-12/h8-16H,2-7H2,1H3/t8-,9-,10+,11-,12?/m1/s1 | | InChIKey | JVAZJLFFSJARQM-OZRWLHRGSA-N | | SMILES | O(CCCCCC)C1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O | | LogP | 1.72 at 20℃ | | EPA Substance Registry System | D-Glucopyranoside, hexyl (54549-24-5) |
| | hexyl D-glucoside Usage And Synthesis |
| Uses |
Hexyl D-glucoside is an extensively employed solubilization compound and detergent in drug formulations and research. Its proficiency in augmenting the solubility of hydrophobic drug entities renders it a quintessential constituent within diverse pharmaceutical arenas.
|
| | hexyl D-glucoside Preparation Products And Raw materials |
|