|
|
| | C8-BTBT Basic information |
| Product Name: | C8-BTBT | | Synonyms: | 2,7-Dioctyl[1]benzothieno[3,2-b][1]benzothiophene;DiC8-BTBT;C8-BTBT;C8-BTBT >=99% (HPLC);[1]Benzothieno[3,2-b][1]benzothiophene, 2,7-dioctyl-;2,7-Dioctyl[1]benzothieno[3,2-b][1];2,7-Dioctylbenzo[b]benzo[4,5]thieno[2,3-d]thiophene;BTBT-C8 2,7-Dioctyl[1]benzothieno[3,2-b][1]benzothiophene | | CAS: | 583050-70-8 | | MF: | C30H40S2 | | MW: | 464.77 | | EINECS: | | | Product Categories: | | | Mol File: | 583050-70-8.mol |  |
| | C8-BTBT Chemical Properties |
| Melting point | 108-112°C | | Boiling point | 595.9±45.0 °C(Predicted) | | density | 1.069±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator, Under inert atmosphere | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly, Sonicated), Methanol (Slightly) | | form | Solid | | color | White to Light Yellow | | semiconductor properties | P-type (mobility=5.5cm2/V·s) | | InChI | InChI=1S/C30H40S2/c1-3-5-7-9-11-13-15-23-17-19-25-27(21-23)31-30-26-20-18-24(22-28(26)32-29(25)30)16-14-12-10-8-6-4-2/h17-22H,3-16H2,1-2H3 | | InChIKey | YWIGIVGUASXDPK-UHFFFAOYSA-N | | SMILES | C12C3=CC=C(CCCCCCCC)C=C3SC=1C1=CC=C(CCCCCCCC)C=C1S2 |
| WGK Germany | 3 | | HS Code | 29349990 |
| | C8-BTBT Usage And Synthesis |
| Uses | High field-effect mobility of 5.5-5.7 cm2/Vs and high On/Off ratio of 109 ; solution-processed (solubility of 80 mg/mL) OFETs | | General Description | C8-BTBT is a conducting polymer with [1]benzothieno[3,2-b][1]- benzothiophene (BTBT) as the base material for the development of air-stable semiconductors. It can form a spin coated thin film that can be used as a p-type semiconductor with charge mobility of 43 cm2V-1s-1. It exhibits highly ordered self-assembled monolayer (SAM) on graphene and hexagonal boron nitride (hBN) with sheet resistance: <1,000 ohm/sq |
| | C8-BTBT Preparation Products And Raw materials |
|