|
|
| | 4,4-Diethoxy-N,N-dimethyl-1-butanamine Basic information |
| | 4,4-Diethoxy-N,N-dimethyl-1-butanamine Chemical Properties |
| Boiling point | 194-195C | | density | 0.844 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.421(lit.) | | Fp | 158 °F | | storage temp. | 2-8°C | | solubility | Chloroform, Ethyl Acetate | | form | Oil | | pka | 9.71±0.28(Predicted) | | color | Colourless to Pale Yellow | | InChI | InChI=1S/C10H23NO2/c1-5-12-10(13-6-2)8-7-9-11(3)4/h10H,5-9H2,1-4H3 | | InChIKey | QKXMWBLNSPNBEY-UHFFFAOYSA-N | | SMILES | C(N(C)C)CCC(OCC)OCC | | CAS DataBase Reference | 1116-77-4(CAS DataBase Reference) |
| | 4,4-Diethoxy-N,N-dimethyl-1-butanamine Usage And Synthesis |
| Chemical Properties | Light yellow liquid | | Uses | 4,4-Diethoxy-N,N-dimethyl-1-butanamine is used in organic synthesis and pharmaceutical intermediates, it is an intermediate for Sumatriptan, Rizatriptan, Almotriptan, Zolmitriptan. | | Application | 4-Dimethylaminobutyraldehyde Diethyl Acetal (Zolmitriptan USP Related Compound H) is used in the preparation of N,N-Dimethyltryptamines, 5-HT1D receptor agonists, for medicinal treatments such as antimigraine drugs. | | Preparation | 4-Dimethylaminobutyraldehyde diethyl acetal synthesis: The reaction of 1-bromo-3-chloro propane and dimethylamine solution with PEG as a phase transfer catalyst, and obtained 3-dimethylamino-1-chloro propane. 3-dimethylamino-1-chloro propane reacted with magnesium and Grinard reagent was acquired. 4-Dimethylaminobutyraldehyde diethyl acetal is obtained by the reaction of Grinard reagent and triethyl orthoformate. The yield was 70.11%. | | Synthesis Reference(s) | Tetrahedron Letters, 35, p. 2401, 1994 DOI: 10.1016/0040-4039(94)85230-8 |
| | 4,4-Diethoxy-N,N-dimethyl-1-butanamine Preparation Products And Raw materials |
|