- Closantel sodium
-
- $0.00 / 25KG
-
2025-03-07
- CAS:61438-64-0
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 50000KG/month
- Closantel sodium
-
- $0.00 / 25kg
-
2025-03-07
- CAS:61438-64-0
- Min. Order: 25kg
- Purity: 99.0%
- Supply Ability: 10tons
|
| | Closantel sodium Basic information |
| Product Name: | Closantel sodium | | Synonyms: | CLOSANTEL(NA);CLOSANTEL SODIUM;closantel sodium salt;n-[5-chloro-4-[(chlorophenyl)cyannomethyl]-2-methylphenyl]-2-hydroxy-3,5-diiodobenzamid sodium salt;sodium N-[5-chloro-4-[(4-chlorophenyl)cyanomethyl]-o-tolyl]-2-hydroxy-3,5-diiodobenzamidate;Benzamide, N-[5-chloro-4-[(4-chlorophenyl)cyanomethyl]-2-methylphenyl]-2-hydroxy-3,5-diiodo-, monosodium salt;CLOSANTELSODIUM(PATENTED);N-[5-Chloro-4-[(4-chlorophenyl)cyanomethyl]-2-methylphenyl]-3,5-diiodo-2-(sodiooxy)benzamide | | CAS: | 61438-64-0 | | MF: | C22H15Cl2I2N2NaO2 | | MW: | 687.07 | | EINECS: | 262-794-7 | | Product Categories: | Inhibitors;API;Intermediates & Fine Chemicals;Pharmaceuticals;Pharmaceutical intermediate | | Mol File: | 61438-64-0.mol |  |
| | Closantel sodium Chemical Properties |
| Melting point | >230°C (dec.) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | White to yellow | | Stability: | Hygroscopic | | InChI | InChI=1S/C22H14Cl2I2N2O2.Na.H/c1-11-6-15(17(10-27)12-2-4-13(23)5-3-12)18(24)9-20(11)28-22(30)16-7-14(25)8-19(26)21(16)29;;/h2-9,17,29H,1H3,(H,28,30);; | | InChIKey | OEGFIKHJXKPQEL-UHFFFAOYSA-N | | SMILES | C(C1C=CC(Cl)=CC=1)(C1C=C(C)C(NC(C2C=C(I)C=C(I)C=2O)=O)=CC=1Cl)C#N.[NaH] | | CAS DataBase Reference | 61438-64-0(CAS DataBase Reference) |
| | Closantel sodium Usage And Synthesis |
| Chemical Properties | Off-White to Pale Yellow Solid | | Uses | As a broad-spectrum anthelmintic, Closantel sodium can be used against nematode infection. |
| | Closantel sodium Preparation Products And Raw materials |
|