|
|
| | 3-Hydroxybutanoic acid magnesium salt Basic information |
| Product Name: | 3-Hydroxybutanoic acid magnesium salt | | Synonyms: | 3-Hydroxybutanoic acid magnesium salt;Magnesium Beta Hydroxybutyrate salt;3-hydroxybutyrate magnesium;Beta hydroxybutyrate Magnesium;BHB magnesium;Magnesium Beta Hydroxybutyrate;3-Hydroxybutanoic acid magnesium;Magnesium 3-hydroxybutyrate BHB Mg | | CAS: | 586976-57-0 | | MF: | C8H14MgO6 | | MW: | 230.49816 | | EINECS: | | | Product Categories: | | | Mol File: | 586976-57-0.mol |  |
| | 3-Hydroxybutanoic acid magnesium salt Chemical Properties |
| InChI | InChI=1S/2C4H8O3.Mg/c2*1-3(5)2-4(6)7;/h2*3,5H,2H2,1H3,(H,6,7);/q;;+2/p-2 | | InChIKey | ZIMQIJFHENOQDO-UHFFFAOYSA-L | | SMILES | [Mg+2].C([O-])(=O)CC(O)C.C([O-])(=O)CC(O)C |
| | 3-Hydroxybutanoic acid magnesium salt Usage And Synthesis |
| Uses | 3-Hydroxybutyric acid magnesium salt is a natural metabolite formed during fat digestion and metabolism, and is called ketone body. Just as glucose is an energy molecule derived from carbohydrates / sugars, while amino acids are derived from proteins, ketones are energy molecules derived from fats.
Magnesium 3-hydroxybutyrate is an energy-intensive molecule that naturally provides energy to your brain, heart and muscles during low carbohydrate intake.
Magnesium 3-hydroxybutyrate is a dietary supplement ingredient and is generally recognized as safe food (GRAS). | | Synthesis | In 500ml there-necked flask, (the R)-ethyl 3-hydroxybutanoate (86.9g) obtained in embodiment 2 is added, is added 300ml water, is slowly added into sodium hydroxide (26.5g) in batches in 2 hours, control temperature is not higher than 10 DEG C, adds continuation reaction 3 small When, reaction solution crosses 732 cationic ion-exchange resins, obtains (R) -3-hydroxybutyrate aqueous solution, is concentrated into 200g/L, in 5 hours in batches Magnesium hydroxide (19.2g) is slowly added into, continuation is added and reacts 5 hours, add 0.3g activated carbons, continues to stir 0.5 hour, mistake Filter, filtrate is concentrated into 100ml, now has a large amount of solids to separate out, is down to and crystallization is stirred at room temperature 1 hour, centrifuges, and vacuum drying is obtained White solid R-3- hydroxybutyric acid magnesium 64.5g, yield 85.0%, ee values are 91.6%. |
| | 3-Hydroxybutanoic acid magnesium salt Preparation Products And Raw materials |
|