- 2,2-Dimethylpiperazine
-
- $2.90 / 1KG
-
2022-02-25
- CAS:84477-72-5
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 1000kg
- 2,2-DIMETHYL-PIPERAZINE
-
- $1.10 / 1g
-
2022-02-25
- CAS:84477-72-5
- Min. Order: 1g
- Purity: 99.00%
- Supply Ability: 100 Tons
|
| | 2,2-DIMETHYL-PIPERAZINE Basic information |
| Product Name: | 2,2-DIMETHYL-PIPERAZINE | | Synonyms: | 2,2-DiMethyl-piperazine 2HCl;2,2-DIMETHYL-PIPERAZINE;Piperazine, 2,2-dimethyl-;2-dimethylpiperazine;cis-2,2-dimethylpiperazine;2,2-DIMETHYL-PIPERAZINE ISO 9001：2015 REACH | | CAS: | 84477-72-5 | | MF: | C6H14N2 | | MW: | 114.19 | | EINECS: | | | Product Categories: | pharmacetical | | Mol File: | 84477-72-5.mol |  |
| | 2,2-DIMETHYL-PIPERAZINE Chemical Properties |
| Boiling point | 155.2±8.0 °C(Predicted) | | density | 0.833±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 9.38±0.40(Predicted) | | form | Solid | | color | Pale Yellow Low Melting | | InChI | InChI=1S/C6H14N2/c1-6(2)5-7-3-4-8-6/h7-8H,3-5H2,1-2H3 | | InChIKey | PIPWSBOFSUJCCO-UHFFFAOYSA-N | | SMILES | N1CCNCC1(C)C |
| Hazard Codes | Xi,N | | Risk Statements | 42-51/53 | | Safety Statements | 61 | | RIDADR | UN3077 |
| | 2,2-DIMETHYL-PIPERAZINE Usage And Synthesis |
| Uses | 2,2-Dimethylpiperazine is a chemical reagent used in the preparation of non-covalent NAAA inhibitors used as a protective agent for the development of multiple sclerosis. |
| | 2,2-DIMETHYL-PIPERAZINE Preparation Products And Raw materials |
|