|
|
| | 5-Hydroxy-1-methylpyrazole Basic information |
| | 5-Hydroxy-1-methylpyrazole Chemical Properties |
| Melting point | 110-114 °C | | Boiling point | 217.7±13.0 °C(Predicted) | | density | 1.22±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | soluble in DMSO, Methanol | | form | powder to crystal | | pka | 9.07±0.23(Predicted) | | color | White to Orange to Green | | InChI | InChI=1S/C4H6N2O/c1-6-4(7)2-3-5-6/h2-3,7H,1H3 | | InChIKey | CMXOTACIOGGSNH-UHFFFAOYSA-N | | SMILES | N1(C)C(O)=CC=N1 |
| Hazard Codes | Xn | | Risk Statements | 22-37/38-41 | | Safety Statements | 26-39 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2933199090 |
| | 5-Hydroxy-1-methylpyrazole Usage And Synthesis |
| Uses | 5-Hydroxy-1-methylpyrazole is a pyrazole derivative used as an intermediate in the preparation of herbicides. |
| | 5-Hydroxy-1-methylpyrazole Preparation Products And Raw materials |
|