- 2-Bromo-5-fluorotoluene
-
- $0.00 / 250KG
-
2025-05-23
- CAS:452-63-1
- Min. Order: 250KG
- Purity: 98%min
- Supply Ability: 30tons/month
- 2-Bromo-5-fluorotoluene
-
- $0.00 / 25KG
-
2025-05-16
- CAS:452-63-1
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 50000KG/month
|
| | 2-Bromo-5-fluorotoluene Basic information |
| | 2-Bromo-5-fluorotoluene Chemical Properties |
| Boiling point | 177 °C/756 mmHg (lit.) | | density | 1.495 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.526(lit.) | | Fp | 113 °F | | storage temp. | Sealed in dry,Room Temperature | | solubility | Difficult to mix. | | form | clear liquid | | color | Colorless to Light yellow to Light orange | | Specific Gravity | 1.495 | | Water Solubility | INSOLUBLE | | BRN | 1859121 | | InChI | InChI=1S/C7H6BrF/c1-5-4-6(9)2-3-7(5)8/h2-4H,1H3 | | InChIKey | RJPNVPITBYXBNB-UHFFFAOYSA-N | | SMILES | C1(Br)=CC=C(F)C=C1C | | CAS DataBase Reference | 452-63-1(CAS DataBase Reference) | | NIST Chemistry Reference | 2-Bromo-5-fluorotoluene(452-63-1) |
| Hazard Codes | Xi | | Risk Statements | 10-36/37/38 | | Safety Statements | 16-26-36/37/39-37/39 | | RIDADR | UN 1993 3/PG 3 | | WGK Germany | 3 | | Hazard Note | Irritant | | HazardClass | 3 | | PackingGroup | III | | HS Code | 29049090 |
| | 2-Bromo-5-fluorotoluene Usage And Synthesis |
| Chemical Properties | colorless to light yellow liqui | | Uses | 2-Bromo-5-fluorotoluene is used to produce other chemicals. It can produce 2-Bromo-5-fluoro-benzoic acid. The reaction occurs with reagent KMnO4, solvent H2O and other condition of heating. | | References | [1] Manfred Baumgarth, & Rolf Gericke. “A Concise and Efficient Synthesis of [2-Methyl-5-methylsulfonyl-4-(pyrrol-1-yl)benzoyl]guanidinium Methanesulfonate (Eniporide).” European Journal of Organic Chemistry 2000 12 (2000): 2253–2255.
|
| | 2-Bromo-5-fluorotoluene Preparation Products And Raw materials |
|