|
|
| | 4-Amino-5-methoxy-2-methylbenzenesulfonic Acid Basic information |
| | 4-Amino-5-methoxy-2-methylbenzenesulfonic Acid Chemical Properties |
| Melting point | >205°C (dec.) | | Boiling point | 398.51℃[at 101 325 Pa] | | density | 1.403±0.06 g/cm3(Predicted) | | vapor pressure | 0Pa at 25℃ | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | DMSO (Slightly, Heated), Water (Slightly, Heated) | | form | Solid | | pka | -1.09±0.50(Predicted) | | color | Light Grey | | Water Solubility | 6.208g/L at 25℃ | | InChI | InChI=1S/C8H11NO4S/c1-5-3-6(9)7(13-2)4-8(5)14(10,11)12/h3-4H,9H2,1-2H3,(H,10,11,12) | | InChIKey | JBAVAJIXZVRJHT-UHFFFAOYSA-N | | SMILES | C1(S(O)(=O)=O)=CC(OC)=C(N)C=C1C | | LogP | -1.45 at 25℃ | | CAS DataBase Reference | 6471-78-9(CAS DataBase Reference) | | EPA Substance Registry System | Benzenesulfonic acid, 4-amino-5-methoxy-2-methyl- (6471-78-9) |
| | 4-Amino-5-methoxy-2-methylbenzenesulfonic Acid Usage And Synthesis |
| Chemical Properties | Light Grey Solid | | Uses | An intermediate of azo dyes. Mutagenic. |
| | 4-Amino-5-methoxy-2-methylbenzenesulfonic Acid Preparation Products And Raw materials |
|