| Identification | Back Directory | [Name]
cefaclor iMpurity C | [CAS]
143059-69-2 | [Synonyms]
cefaclor iMpurity C
Cefaclor (2S)-Isomer
Cefaclor Impurity C (EP)
Cefaclor EP Impurity C HCl
(6R,7R)-7-[[(2S)-2-AMINO-2-PHENYLACETYL]AMINO]-3-CHLORO-8-OXO-5-THIA-1-AZABICYCLO[4.2.0]OCT-2-ENE-2-CARBOXYLIC ACID
5-Thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid, 7-[(aminophenylacetyl)amino]-3-chloro-8-oxo-, [6R-[6α,7β(S*)]]- (9CI)
Cefaclor impurity 2/Cefaclor EP Impurity C/(6R,7R)-7-((S)-2-amino-2-phenylacetamido)-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid | [Molecular Formula]
C15H14ClN3O4S | [MDL Number]
MFCD00151471 | [MOL File]
143059-69-2.mol | [Molecular Weight]
367.8 |
| Chemical Properties | Back Directory | [Boiling point ]
713.4±60.0 °C(Predicted) | [density ]
1.62±0.1 g/cm3(Predicted) | [pka]
1.95±0.50(Predicted) | [InChI]
InChI=1/C15H14ClN3O4S/c16-8-6-24-14-10(13(21)19(14)11(8)15(22)23)18-12(20)9(17)7-4-2-1-3-5-7/h1-5,9-10,14H,6,17H2,(H,18,20)(H,22,23)/t9-,10+,14+/s3 | [InChIKey]
QYIYFLOTGYLRGG-SGYQERQLNA-N | [SMILES]
O=C1[C@@H](NC(=O)[C@H](C2C=CC=CC=2)N)[C@@]2([H])SCC(Cl)=C(C(=O)O)N12 |&1:2,6,14,r| |
| Hazard Information | Back Directory | [Definition]
ChEBI: Cefaclor is a cephalosporin bearing chloro and (R)-2-amino-2-phenylacetamido groups at positions 3 and 7, respectively, of the cephem skeleton. It has a role as an antibacterial drug and a drug allergen. |
|
| Company Name: |
BOC Sciences
|
| Tel: |
1-631-485-4226; 16314854226 |
| Website: |
https://www.bocsci.com |
| Company Name: |
BOC Sciences
|
| Tel: |
16314854226 |
| Website: |
www.bocsci.com |
| Company Name: |
TOSUN PHARM
|
| Tel: |
020-61855200 13326451905 |
| Website: |
www.toref.cn/ |
|