- 4-Nitrofluorescein
-
- $1.00 / 1KG
-
2024-07-11
- CAS:3326-35-0
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20T
|
| | 4-Nitrofluorescein Basic information |
| Product Name: | 4-Nitrofluorescein | | Synonyms: | 4-NITROFLUOROESCEIN;5-NITRO-3',6'-DIHYDROXYSPIRO[ISOBENZOFURAN-1(3H),9'-(9H)XANTHEN]-3-ONE;4-NITROFLUORESCEIN;3',6'-Dihydroxy-5-nitrospiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one;5-Nitro-3',6'-dihydroxyspiro[isobenzofuran-1(3H),9'-[9H]xanthene]-3-one;3',6'-dihydroxy-6-nitro-spiro[2-benzofuran-3,9'-xanthene]-1-one;3',6'-dihydroxy-6-nitrospiro[2-benzofuran-3,9'-xanthene]-1-one;3',6'-dihydroxy-6-nitro-spiro[isobenzofuran-3,9'-xanthene]-1-one | | CAS: | 3326-35-0 | | MF: | C20H11NO7 | | MW: | 377.3 | | EINECS: | | | Product Categories: | Fluorescent Labels & Indicators | | Mol File: | 3326-35-0.mol |  |
| | 4-Nitrofluorescein Chemical Properties |
| Melting point | >300°C | | Boiling point | 692.0±55.0 °C(Predicted) | | density | 1.72±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | almost transparency in NaOH100g/L | | form | powder to crystal | | pka | 9.29±0.20(Predicted) | | color | Light yellow to Brown | | Stability: | Light and Moisture Sensitive | | InChI | InChI=1S/C20H11NO7/c22-11-2-5-15-17(8-11)27-18-9-12(23)3-6-16(18)20(15)14-4-1-10(21(25)26)7-13(14)19(24)28-20/h1-9,22-23H | | InChIKey | UACQOMKZFGNRBL-UHFFFAOYSA-N | | SMILES | C12(C3=C(C=C(O)C=C3)OC3=C1C=CC(O)=C3)C1=C(C=C([N+]([O-])=O)C=C1)C(=O)O2 | | EPA Substance Registry System | |
| | 4-Nitrofluorescein Usage And Synthesis |
| Chemical Properties | Orange Cyrstalline Solid | | Uses | Fluorescent labeling reagent for proteins. 4-Nitrofluorescein is used in the fluorescent antibody technique for rapid identification of pathogens. |
| | 4-Nitrofluorescein Preparation Products And Raw materials |
|