|
| 1,2-BIS(TRIMETHOXYSILYL)ETHANE Basic information |
| 1,2-BIS(TRIMETHOXYSILYL)ETHANE Chemical Properties |
Melting point | <0°C | Boiling point | 103-104 °C5 mm Hg(lit.) | density | 1.073 g/mL at 25 °C(lit.) | vapor pressure | 1.2Pa at 20℃ | refractive index | n20/D 1.409(lit.) | Fp | 228 °F | form | Liquid | Specific Gravity | 1.09 | color | Colorless | Hydrolytic Sensitivity | 7: reacts slowly with moisture/water | InChI | InChI=1S/C8H22O6Si2/c1-9-15(10-2,11-3)7-8-16(12-4,13-5)14-6/h7-8H2,1-6H3 | InChIKey | JCGDCINCKDQXDX-UHFFFAOYSA-N | SMILES | CO[Si](OC)(OC)CC[Si](OC)(OC)OC | LogP | -1.68 at 25℃ | CAS DataBase Reference | 18406-41-2(CAS DataBase Reference) | EPA Substance Registry System | 2,7-Dioxa-3,6-disilaoctane, 3,3,6,6-tetramethoxy- (18406-41-2) |
Hazard Codes | T+ | Risk Statements | 26 | Safety Statements | 23-36/37-45 | RIDADR | UN 3382 6.1/PG 1 | WGK Germany | 3 | RTECS | JG7873000 | TSCA | Yes | HazardClass | 6.1 | HS Code | 29319090 |
| 1,2-BIS(TRIMETHOXYSILYL)ETHANE Usage And Synthesis |
Chemical Properties | Colorless liquid | Uses | 3,3,6,6-Tetramethoxy-2,7-dioxa-3,6-disilaoctane is useful in the preparation of functionalized periodic mesoporous organosilicas for selective adsorption of proteins. | Flammability and Explosibility | Not classified |
| 1,2-BIS(TRIMETHOXYSILYL)ETHANE Preparation Products And Raw materials |
|