|
|
| | N-Succinimidyl maleimidoacetate Basic information |
| | N-Succinimidyl maleimidoacetate Chemical Properties |
| Melting point | 174-175°C | | Boiling point | 430.1±47.0 °C(Predicted) | | density | 1.63±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | solubility | Chloroform (Slightly), DMSO (Slightly), Ethyl Acetate (Slightly, Heated) | | form | Solid | | pka | -2.69±0.20(Predicted) | | color | White to Off-White | | InChI | InChI=1S/C10H8N2O6/c13-6-1-2-7(14)11(6)5-10(17)18-12-8(15)3-4-9(12)16/h1-2H,3-5H2 | | InChIKey | TYKASZBHFXBROF-UHFFFAOYSA-N | | SMILES | N1(CC(ON2C(=O)CCC2=O)=O)C(=O)C=CC1=O | | CAS DataBase Reference | 55750-61-3 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 29280000 |
| | N-Succinimidyl maleimidoacetate Usage And Synthesis |
| Chemical Properties | White Crystalline Solid | | Uses | A hetero-bifunctional cross-linking reagent for the preparation of protein-protein or protein-hapten conjugates. | | Uses | Maleimidoacetic acid N-hydroxysuccinimide ester is a crosslinking reagent that contains NHS ester- and maleimide-reactive groups at the opposite ends of a 4.4 ? spacer arm. This configuration allows for sequential, two-stage conjugation with amine and sulfhydryl functional groups in the preparation of protein-hapten or protein-protein conjugates. |
| | N-Succinimidyl maleimidoacetate Preparation Products And Raw materials |
|