| Chemical Properties | Back Directory | [Boiling point ]
529.2±42.0 °C(Predicted) | [density ]
1.37±0.1 g/cm3(Predicted) | [pka]
8.20±0.30(Predicted) | [InChI]
InChI=1S/C16H11BO3/c18-17(19)13-6-3-7-14-16(13)12-8-10-4-1-2-5-11(10)9-15(12)20-14/h1-9,18-19H | [InChIKey]
GUPYETLVSSDKRR-UHFFFAOYSA-N | [SMILES]
B(C1=C2C3=CC4C(=CC=CC=4)C=C3OC2=CC=C1)(O)O |
| Hazard Information | Back Directory | [Chemical Properties]
Naphtho[2,3-B]benzofuran-1-ylboronic acid is a red-brown crystalline powder.
It is very soluble in N,N-Dimethylformamide,Soluble in methanol,Sparingly soluble inglacial acetic acid, Very slightly soluble inchloroform, Practically insoluble in water. | [Uses]
Naphtho[2,3-B]benzofuran-1-ylboronic acid is a chemical compound with
the formula C16H11BO3 and a molecular weight of 262.07g/mol. It is mainly used to make liquid crystals. | [Application]
Naphtho[2,3-B]benzofuran-1-ylboronic acid could used to synthesize organic compound which could used as the host material of the light-emitting layer organic electroluminescence element. | [Preparation]
Naphtho[2,3-b]benzofuran-2-ylboronic acid can be synthesized using several methods, including Suzuki-Miyaura cross-coupling reactions, boronate esterification, and direct boronic acid functionalization. | [Biological Activity]
Naphtho[2,3-b]benzofuran-2-ylboronic acid has been found to exert various effects on cell function and signal transduction. It can influence cellular processes, including proliferation, apoptosis, and differentiation. Additionally, this compound has demonstrated potential therapeutic effects in the treatment of certain diseases, such as cancer, neurodegenerative disorders, and inflammatory conditions. |
|
|