| Identification | Back Directory | [Name]
1,4-Dideoxy-1,4-epithio-D-ribitol | [CAS]
190315-43-6 | [Synonyms]
1,4-anhydro-4-thio-D-ribitol
1,4-Dideoxy-1,4-epithio-D-ribitol | [Molecular Formula]
C5H10O3S | [MDL Number]
MFCD27921043 | [MOL File]
190315-43-6.mol | [Molecular Weight]
150.196 |
| Chemical Properties | Back Directory | [Boiling point ]
327.4±42.0 °C(Predicted) | [density ]
1.490±0.06 g/cm3(Predicted) | [pka]
13.65±0.60(Predicted) | [InChI]
InChI=1S/C5H10O3S/c6-1-4-5(8)3(7)2-9-4/h3-8H,1-2H2/t3-,4+,5-/m0/s1 | [InChIKey]
VLVSFIRYIVAVKW-LMVFSUKVSA-N | [SMILES]
C1S[C@H](CO)[C@@H](O)[C@H]1O |
| Hazard Information | Back Directory | [Description]
1,4-Dideoxy-1,4-epithio-D-ribitol ((2R,3S,4R)-2-(hydroxymethyl)thiolane-3,4-diol), an indispensable compound in the field of biomedicine, is known for its significant role in combating viral infections. Primarily utilized as an anti-viral agent, this marvelously intricate molecule exhibits remarkable efficacy in hindering the replication and dissemination of notorious viruses, including herpes simplex virus and Epstein-Barr virus. By impeding their proliferation, it effectively contributes to the amelioration and prophylaxis of afflictions closely associated with these pathogens. |
|
| Company Name: |
BOC Sciences
|
| Tel: |
16314854226 |
| Website: |
www.approvedhomemanagement.com/showsupplierproductslist1701258/0.htm |
|